C11H17N — CID 142179771
(3Z)-N-ethenyl-N-(2-methylprop-1-enyl)penta-1,3-dien-2-amine (PubChem CID 142179771) has the molecular formula C11H17N and a molecular weight of 163.26 g/mol. Its IUPAC name is (3Z)-N-ethenyl-N-(2-methylprop-1-enyl)penta-1,3-dien-2-amine.
| Compound Name | (3Z)-N-ethenyl-N-(2-methylprop-1-enyl)penta-1,3-dien-2-amine |
|---|---|
| PubChem CID | 142179771 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | (3Z)-N-ethenyl-N-(2-methylprop-1-enyl)penta-1,3-dien-2-amine |
| SMILES | C=CN(C=C(C)C)C(=C)/C=C\C |
| InChI | InChI=1S/C11H17N/c1-6-8-11(5)12(7-2)9-10(3)4/h6-9H,2,5H2,1,3-4H3/b8-6- |
| InChIKey | DXIKQQAAEYOSPQ-VURMDHGXSA-N |
| XLogP | 3.45 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|