C37H48FNO — CID 142180031
6-butyl-10-[6-[1-(2-fluorophenyl)cyclopentyl]-3,4-dihydropyridin-2-yl]-1-(4-methylphenyl)dec-9-en-1-one (PubChem CID 142180031) has the molecular formula C37H48FNO and a molecular weight of 541.80 g/mol. Its IUPAC name is 6-butyl-10-[6-[1-(2-fluorophenyl)cyclopentyl]-3,4-dihydropyridin-2-yl]-1-(4-methylphenyl)dec-9-en-1-one.
| Compound Name | 6-butyl-10-[6-[1-(2-fluorophenyl)cyclopentyl]-3,4-dihydropyridin-2-yl]-1-(4-methylphenyl)dec-9-en-1-one |
|---|---|
| PubChem CID | 142180031 |
| Molecular Formula | C37H48FNO |
| Molecular Weight | 541.80 g/mol |
| Exact Mass | 541.37 |
| IUPAC Name | 6-butyl-10-[6-[1-(2-fluorophenyl)cyclopentyl]-3,4-dihydropyridin-2-yl]-1-(4-methylphenyl)dec-9-en-1-one |
| SMILES | CCCCC(CCC=CC1=NC(C2(c3ccccc3F)CCCC2)=CCC1)CCCCC(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C37H48FNO/c1-3-4-14-30(16-6-10-21-35(40)31-25-23-29(2)24-26-31)15-5-7-17-32-18-13-22-36(39-32)37(27-11-12-28-37)33-19-8-9-20-34(33)38/h7-9,17,19-20,22-26,30H,3-6,10-16,18,21,27-28H2,1-2H3 |
| InChIKey | ZBEYTGSANVUROJ-UHFFFAOYSA-N |
| XLogP | 10.65 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.80 |
| LogP ≤ 5 | 10.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|