About 2-methylpropane;(Z)-2-propan-2-yloxybut-2-en-1-amine
2-methylpropane;(Z)-2-propan-2-yloxybut-2-en-1-amine (PubChem CID 142180418) has the molecular formula C11H25NO
and a molecular weight of 187.33 g/mol. Its IUPAC name is 2-methylpropane;(Z)-2-propan-2-yloxybut-2-en-1-amine.
Molecular Properties
| Compound Name | 2-methylpropane;(Z)-2-propan-2-yloxybut-2-en-1-amine |
| PubChem CID | 142180418 |
| Molecular Formula | C11H25NO |
| Molecular Weight | 187.33 g/mol |
| Exact Mass | 187.19 |
| IUPAC Name | 2-methylpropane;(Z)-2-propan-2-yloxybut-2-en-1-amine |
| SMILES | C/C=C(/CN)OC(C)C.CC(C)C |
| InChI | InChI=1S/C7H15NO.C4H10/c1-4-7(5-8)9-6(2)3;1-4(2)3/h4,6H,5,8H2,1-3H3;4H,1-3H3/b7-4-; |
| InChIKey | XRWRGDMDBFSQHM-ZULQGGHCSA-N |
| XLogP | 2.94 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.33 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropane;(Z)-2-propan-2-yloxybut-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropane;(Z)-2-propan-2-yloxybut-2-en-1-amine?
The IUPAC name of 2-methylpropane;(Z)-2-propan-2-yloxybut-2-en-1-amine (CID 142180418) is 2-methylpropane;(Z)-2-propan-2-yloxybut-2-en-1-amine.
What is the SMILES notation for 2-methylpropane;(Z)-2-propan-2-yloxybut-2-en-1-amine?
The canonical SMILES for 2-methylpropane;(Z)-2-propan-2-yloxybut-2-en-1-amine is C/C=C(/CN)OC(C)C.CC(C)C.
What is the InChIKey of 2-methylpropane;(Z)-2-propan-2-yloxybut-2-en-1-amine?
The InChIKey is XRWRGDMDBFSQHM-ZULQGGHCSA-N. The full InChI is InChI=1S/C7H15NO.C4H10/c1-4-7(5-8)9-6(2)3;1-4(2)3/h4,6H,5,8H2,1-3H3;4H,1-3H3/b7-4-;.
What are the key properties of 2-methylpropane;(Z)-2-propan-2-yloxybut-2-en-1-amine?
2-methylpropane;(Z)-2-propan-2-yloxybut-2-en-1-amine has a molecular weight of 187.33 g/mol, XLogP of 2.94, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropane;(Z)-2-propan-2-yloxybut-2-en-1-amine is sourced from PubChem (CID 142180418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).