About (Z)-2-methoxy-4,5-dimethylhex-2-en-1-amine
(Z)-2-methoxy-4,5-dimethylhex-2-en-1-amine (PubChem CID 142180786) has the molecular formula C9H19NO
and a molecular weight of 157.26 g/mol. Its IUPAC name is (Z)-2-methoxy-4,5-dimethylhex-2-en-1-amine.
Molecular Properties
| Compound Name | (Z)-2-methoxy-4,5-dimethylhex-2-en-1-amine |
| PubChem CID | 142180786 |
| Molecular Formula | C9H19NO |
| Molecular Weight | 157.26 g/mol |
| Exact Mass | 157.15 |
| IUPAC Name | (Z)-2-methoxy-4,5-dimethylhex-2-en-1-amine |
| SMILES | CO/C(=C\C(C)C(C)C)CN |
| InChI | InChI=1S/C9H19NO/c1-7(2)8(3)5-9(6-10)11-4/h5,7-8H,6,10H2,1-4H3/b9-5- |
| InChIKey | BHFMQTPNHZEWDM-UITAMQMPSA-N |
| XLogP | 1.77 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.26 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-methoxy-4,5-dimethylhex-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-methoxy-4,5-dimethylhex-2-en-1-amine?
The IUPAC name of (Z)-2-methoxy-4,5-dimethylhex-2-en-1-amine (CID 142180786) is (Z)-2-methoxy-4,5-dimethylhex-2-en-1-amine.
What is the SMILES notation for (Z)-2-methoxy-4,5-dimethylhex-2-en-1-amine?
The canonical SMILES for (Z)-2-methoxy-4,5-dimethylhex-2-en-1-amine is CO/C(=C\C(C)C(C)C)CN.
What is the InChIKey of (Z)-2-methoxy-4,5-dimethylhex-2-en-1-amine?
The InChIKey is BHFMQTPNHZEWDM-UITAMQMPSA-N. The full InChI is InChI=1S/C9H19NO/c1-7(2)8(3)5-9(6-10)11-4/h5,7-8H,6,10H2,1-4H3/b9-5-.
What are the key properties of (Z)-2-methoxy-4,5-dimethylhex-2-en-1-amine?
(Z)-2-methoxy-4,5-dimethylhex-2-en-1-amine has a molecular weight of 157.26 g/mol, XLogP of 1.77, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-methoxy-4,5-dimethylhex-2-en-1-amine is sourced from PubChem (CID 142180786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).