C25H29N3O4 — CID 142180798
N,N-dimethylformamide;3-(2-hydroxy-3-methylanilino)-4-[(1-phenylcyclopentyl)amino]cyclobut-3-ene-1,2-dione (PubChem CID 142180798) has the molecular formula C25H29N3O4 and a molecular weight of 435.52 g/mol. Its IUPAC name is N,N-dimethylformamide;3-(2-hydroxy-3-methylanilino)-4-[(1-phenylcyclopentyl)amino]cyclobut-3-ene-1,2-dione.
| Compound Name | N,N-dimethylformamide;3-(2-hydroxy-3-methylanilino)-4-[(1-phenylcyclopentyl)amino]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 142180798 |
| Molecular Formula | C25H29N3O4 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | N,N-dimethylformamide;3-(2-hydroxy-3-methylanilino)-4-[(1-phenylcyclopentyl)amino]cyclobut-3-ene-1,2-dione |
| SMILES | CN(C)C=O.Cc1cccc(Nc2c(NC3(c4ccccc4)CCCC3)c(=O)c2=O)c1O |
| InChI | InChI=1S/C22H22N2O3.C3H7NO/c1-14-8-7-11-16(19(14)25)23-17-18(21(27)20(17)26)24-22(12-5-6-13-22)15-9-3-2-4-10-15;1-4(2)3-5/h2-4,7-11,23-25H,5-6,12-13H2,1H3;3H,1-2H3 |
| InChIKey | JNBVQMLMTNFEBZ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|