About 2-[(2E)-2-cyano-2-[(2,4-dibromophenyl)hydrazinylidene]acetyl]oxyethyl 2-cyanoprop-2-enoate
2-[(2E)-2-cyano-2-[(2,4-dibromophenyl)hydrazinylidene]acetyl]oxyethyl 2-cyanoprop-2-enoate (PubChem CID 142180884) has the molecular formula C15H10Br2N4O4
and a molecular weight of 470.08 g/mol. Its IUPAC name is 2-[(2E)-2-cyano-2-[(2,4-dibromophenyl)hydrazinylidene]acetyl]oxyethyl 2-cyanoprop-2-enoate.
Molecular Properties
| Compound Name | 2-[(2E)-2-cyano-2-[(2,4-dibromophenyl)hydrazinylidene]acetyl]oxyethyl 2-cyanoprop-2-enoate |
| PubChem CID | 142180884 |
| Molecular Formula | C15H10Br2N4O4 |
| Molecular Weight | 470.08 g/mol |
| Exact Mass | 467.91 |
| IUPAC Name | 2-[(2E)-2-cyano-2-[(2,4-dibromophenyl)hydrazinylidene]acetyl]oxyethyl 2-cyanoprop-2-enoate |
| SMILES | C=C(C#N)C(=O)OCCOC(=O)/C(C#N)=N/Nc1ccc(Br)cc1Br |
| InChI | InChI=1S/C15H10Br2N4O4/c1-9(7-18)14(22)24-4-5-25-15(23)13(8-19)21-20-12-3-2-10(16)6-11(12)17/h2-3,6,20H,1,4-5H2/b21-13+ |
| InChIKey | CEKBTODYKDDQLX-FYJGNVAPSA-N |
| XLogP | 2.67 |
| TPSA | 124.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 470.08 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2E)-2-cyano-2-[(2,4-dibromophenyl)hydrazinylidene]acetyl]oxyethyl 2-cyanoprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2E)-2-cyano-2-[(2,4-dibromophenyl)hydrazinylidene]acetyl]oxyethyl 2-cyanoprop-2-enoate?
The IUPAC name of 2-[(2E)-2-cyano-2-[(2,4-dibromophenyl)hydrazinylidene]acetyl]oxyethyl 2-cyanoprop-2-enoate (CID 142180884) is 2-[(2E)-2-cyano-2-[(2,4-dibromophenyl)hydrazinylidene]acetyl]oxyethyl 2-cyanoprop-2-enoate.
What is the SMILES notation for 2-[(2E)-2-cyano-2-[(2,4-dibromophenyl)hydrazinylidene]acetyl]oxyethyl 2-cyanoprop-2-enoate?
The canonical SMILES for 2-[(2E)-2-cyano-2-[(2,4-dibromophenyl)hydrazinylidene]acetyl]oxyethyl 2-cyanoprop-2-enoate is C=C(C#N)C(=O)OCCOC(=O)/C(C#N)=N/Nc1ccc(Br)cc1Br.
What is the InChIKey of 2-[(2E)-2-cyano-2-[(2,4-dibromophenyl)hydrazinylidene]acetyl]oxyethyl 2-cyanoprop-2-enoate?
The InChIKey is CEKBTODYKDDQLX-FYJGNVAPSA-N. The full InChI is InChI=1S/C15H10Br2N4O4/c1-9(7-18)14(22)24-4-5-25-15(23)13(8-19)21-20-12-3-2-10(16)6-11(12)17/h2-3,6,20H,1,4-5H2/b21-13+.
What are the key properties of 2-[(2E)-2-cyano-2-[(2,4-dibromophenyl)hydrazinylidene]acetyl]oxyethyl 2-cyanoprop-2-enoate?
2-[(2E)-2-cyano-2-[(2,4-dibromophenyl)hydrazinylidene]acetyl]oxyethyl 2-cyanoprop-2-enoate has a molecular weight of 470.08 g/mol, XLogP of 2.67, 7 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2E)-2-cyano-2-[(2,4-dibromophenyl)hydrazinylidene]acetyl]oxyethyl 2-cyanoprop-2-enoate is sourced from PubChem (CID 142180884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).