C30H29N5O2S — CID 142181035
2-[3-[4-[3-[[(Z)-1-(1-methylcyclopropyl)but-1-enyl]amino]anilino]sulfanylphenyl]-1,2,4-oxadiazol-5-yl]-1H-indol-5-ol (PubChem CID 142181035) has the molecular formula C30H29N5O2S and a molecular weight of 523.66 g/mol. Its IUPAC name is 2-[3-[4-[3-[[(Z)-1-(1-methylcyclopropyl)but-1-enyl]amino]anilino]sulfanylphenyl]-1,2,4-oxadiazol-5-yl]-1H-indol-5-ol.
| Compound Name | 2-[3-[4-[3-[[(Z)-1-(1-methylcyclopropyl)but-1-enyl]amino]anilino]sulfanylphenyl]-1,2,4-oxadiazol-5-yl]-1H-indol-5-ol |
|---|---|
| PubChem CID | 142181035 |
| Molecular Formula | C30H29N5O2S |
| Molecular Weight | 523.66 g/mol |
| Exact Mass | 523.20 |
| IUPAC Name | 2-[3-[4-[3-[[(Z)-1-(1-methylcyclopropyl)but-1-enyl]amino]anilino]sulfanylphenyl]-1,2,4-oxadiazol-5-yl]-1H-indol-5-ol |
| SMILES | CC/C=C(\Nc1cccc(NSc2ccc(-c3noc(-c4cc5cc(O)ccc5[nH]4)n3)cc2)c1)C1(C)CC1 |
| InChI | InChI=1S/C30H29N5O2S/c1-3-5-27(30(2)14-15-30)31-21-6-4-7-22(18-21)35-38-24-11-8-19(9-12-24)28-33-29(37-34-28)26-17-20-16-23(36)10-13-25(20)32-26/h4-13,16-18,31-32,35-36H,3,14-15H2,1-2H3/b27-5- |
| InChIKey | NMITXXLTOHCEGZ-HCEIJDMSSA-N |
| XLogP | 8.22 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.66 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|