About 5-ethyl-4-methoxy-1,3-dimethylpyrazolo[3,4-b]pyridine
5-ethyl-4-methoxy-1,3-dimethylpyrazolo[3,4-b]pyridine (PubChem CID 142181984) has the molecular formula C11H15N3O
and a molecular weight of 205.26 g/mol. Its IUPAC name is 5-ethyl-4-methoxy-1,3-dimethylpyrazolo[3,4-b]pyridine.
Molecular Properties
| Compound Name | 5-ethyl-4-methoxy-1,3-dimethylpyrazolo[3,4-b]pyridine |
| PubChem CID | 142181984 |
| Molecular Formula | C11H15N3O |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.12 |
| IUPAC Name | 5-ethyl-4-methoxy-1,3-dimethylpyrazolo[3,4-b]pyridine |
| SMILES | CCc1cnc2c(c(C)nn2C)c1OC |
| InChI | InChI=1S/C11H15N3O/c1-5-8-6-12-11-9(10(8)15-4)7(2)13-14(11)3/h6H,5H2,1-4H3 |
| InChIKey | QWCKNDDWNNPXLH-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-ethyl-4-methoxy-1,3-dimethylpyrazolo[3,4-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-4-methoxy-1,3-dimethylpyrazolo[3,4-b]pyridine?
The IUPAC name of 5-ethyl-4-methoxy-1,3-dimethylpyrazolo[3,4-b]pyridine (CID 142181984) is 5-ethyl-4-methoxy-1,3-dimethylpyrazolo[3,4-b]pyridine.
What is the SMILES notation for 5-ethyl-4-methoxy-1,3-dimethylpyrazolo[3,4-b]pyridine?
The canonical SMILES for 5-ethyl-4-methoxy-1,3-dimethylpyrazolo[3,4-b]pyridine is CCc1cnc2c(c(C)nn2C)c1OC.
What is the InChIKey of 5-ethyl-4-methoxy-1,3-dimethylpyrazolo[3,4-b]pyridine?
The InChIKey is QWCKNDDWNNPXLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N3O/c1-5-8-6-12-11-9(10(8)15-4)7(2)13-14(11)3/h6H,5H2,1-4H3.
What are the key properties of 5-ethyl-4-methoxy-1,3-dimethylpyrazolo[3,4-b]pyridine?
5-ethyl-4-methoxy-1,3-dimethylpyrazolo[3,4-b]pyridine has a molecular weight of 205.26 g/mol, XLogP of 1.85, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-4-methoxy-1,3-dimethylpyrazolo[3,4-b]pyridine is sourced from PubChem (CID 142181984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).