C26H52N2O7 — CID 142182634
methyl (4S,5R,8R)-9-(3,4-dihydroxypentan-2-ylamino)-5-[4-(dimethylamino)-6-methyloxan-2-yl]oxy-6-hydroxy-2,4,8-trimethylnonanoate (PubChem CID 142182634) has the molecular formula C26H52N2O7 and a molecular weight of 504.71 g/mol. Its IUPAC name is methyl (4S,5R,8R)-9-(3,4-dihydroxypentan-2-ylamino)-5-[4-(dimethylamino)-6-methyloxan-2-yl]oxy-6-hydroxy-2,4,8-trimethylnonanoate.
| Compound Name | methyl (4S,5R,8R)-9-(3,4-dihydroxypentan-2-ylamino)-5-[4-(dimethylamino)-6-methyloxan-2-yl]oxy-6-hydroxy-2,4,8-trimethylnonanoate |
|---|---|
| PubChem CID | 142182634 |
| Molecular Formula | C26H52N2O7 |
| Molecular Weight | 504.71 g/mol |
| Exact Mass | 504.38 |
| IUPAC Name | methyl (4S,5R,8R)-9-(3,4-dihydroxypentan-2-ylamino)-5-[4-(dimethylamino)-6-methyloxan-2-yl]oxy-6-hydroxy-2,4,8-trimethylnonanoate |
| SMILES | COC(=O)C(C)C[C@H](C)[C@@H](OC1CC(N(C)C)CC(C)O1)C(O)C[C@@H](C)CNC(C)C(O)C(C)O |
| InChI | InChI=1S/C26H52N2O7/c1-15(14-27-19(5)24(31)20(6)29)10-22(30)25(16(2)11-17(3)26(32)33-9)35-23-13-21(28(7)8)12-18(4)34-23/h15-25,27,29-31H,10-14H2,1-9H3/t15-,16+,17?,18?,19?,20?,21?,22?,23?,24?,25-/m1/s1 |
| InChIKey | PAZOFKUERUSXJY-IVVAJRSOSA-N |
| XLogP | 1.77 |
| TPSA | 120.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.71 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |