C25H50N2O7 — CID 142182643
(5R)-9-[[(4R)-3,4-dihydroxy-5-methoxy-4-methylpentan-2-yl]amino]-5-[4-(dimethylamino)-6-methyloxan-2-yl]oxy-6-hydroxy-2-methylnonanal (PubChem CID 142182643) has the molecular formula C25H50N2O7 and a molecular weight of 490.68 g/mol. Its IUPAC name is (5R)-9-[[(4R)-3,4-dihydroxy-5-methoxy-4-methylpentan-2-yl]amino]-5-[4-(dimethylamino)-6-methyloxan-2-yl]oxy-6-hydroxy-2-methylnonanal.
| Compound Name | (5R)-9-[[(4R)-3,4-dihydroxy-5-methoxy-4-methylpentan-2-yl]amino]-5-[4-(dimethylamino)-6-methyloxan-2-yl]oxy-6-hydroxy-2-methylnonanal |
|---|---|
| PubChem CID | 142182643 |
| Molecular Formula | C25H50N2O7 |
| Molecular Weight | 490.68 g/mol |
| Exact Mass | 490.36 |
| IUPAC Name | (5R)-9-[[(4R)-3,4-dihydroxy-5-methoxy-4-methylpentan-2-yl]amino]-5-[4-(dimethylamino)-6-methyloxan-2-yl]oxy-6-hydroxy-2-methylnonanal |
| SMILES | COC[C@@](C)(O)C(O)C(C)NCCCC(O)[C@@H](CCC(C)C=O)OC1CC(N(C)C)CC(C)O1 |
| InChI | InChI=1S/C25H50N2O7/c1-17(15-28)10-11-22(34-23-14-20(27(5)6)13-18(2)33-23)21(29)9-8-12-26-19(3)24(30)25(4,31)16-32-7/h15,17-24,26,29-31H,8-14,16H2,1-7H3/t17?,18?,19?,20?,21?,22-,23?,24?,25-/m1/s1 |
| InChIKey | WCHGUJRIUHMPRN-BIMNEMJBSA-N |
| XLogP | 1.32 |
| TPSA | 120.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.68 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|