About 1-carbazol-9-ylethanone;ethane
1-carbazol-9-ylethanone;ethane (PubChem CID 142183368) has the molecular formula C16H17NO
and a molecular weight of 239.32 g/mol. Its IUPAC name is 1-carbazol-9-ylethanone;ethane.
Molecular Properties
| Compound Name | 1-carbazol-9-ylethanone;ethane |
| PubChem CID | 142183368 |
| Molecular Formula | C16H17NO |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | 1-carbazol-9-ylethanone;ethane |
| SMILES | CC.CC(=O)n1c2ccccc2c2ccccc21 |
| InChI | InChI=1S/C14H11NO.C2H6/c1-10(16)15-13-8-4-2-6-11(13)12-7-3-5-9-14(12)15;1-2/h2-9H,1H3;1-2H3 |
| InChIKey | FGCJFZKNCAAVLG-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-carbazol-9-ylethanone;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-carbazol-9-ylethanone;ethane?
The IUPAC name of 1-carbazol-9-ylethanone;ethane (CID 142183368) is 1-carbazol-9-ylethanone;ethane.
What is the SMILES notation for 1-carbazol-9-ylethanone;ethane?
The canonical SMILES for 1-carbazol-9-ylethanone;ethane is CC.CC(=O)n1c2ccccc2c2ccccc21.
What is the InChIKey of 1-carbazol-9-ylethanone;ethane?
The InChIKey is FGCJFZKNCAAVLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11NO.C2H6/c1-10(16)15-13-8-4-2-6-11(13)12-7-3-5-9-14(12)15;1-2/h2-9H,1H3;1-2H3.
What are the key properties of 1-carbazol-9-ylethanone;ethane?
1-carbazol-9-ylethanone;ethane has a molecular weight of 239.32 g/mol, XLogP of 4.48, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-carbazol-9-ylethanone;ethane is sourced from PubChem (CID 142183368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).