About ethane;1-methoxy-4-(trifluoromethyl)cyclohexa-1,3-diene
ethane;1-methoxy-4-(trifluoromethyl)cyclohexa-1,3-diene (PubChem CID 142183376) has the molecular formula C10H15F3O
and a molecular weight of 208.22 g/mol. Its IUPAC name is ethane;1-methoxy-4-(trifluoromethyl)cyclohexa-1,3-diene.
Molecular Properties
| Compound Name | ethane;1-methoxy-4-(trifluoromethyl)cyclohexa-1,3-diene |
| PubChem CID | 142183376 |
| Molecular Formula | C10H15F3O |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | ethane;1-methoxy-4-(trifluoromethyl)cyclohexa-1,3-diene |
| SMILES | CC.COC1=CC=C(C(F)(F)F)CC1 |
| InChI | InChI=1S/C8H9F3O.C2H6/c1-12-7-4-2-6(3-5-7)8(9,10)11;1-2/h2,4H,3,5H2,1H3;1-2H3 |
| InChIKey | COAMBPHVFQHQAV-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;1-methoxy-4-(trifluoromethyl)cyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-methoxy-4-(trifluoromethyl)cyclohexa-1,3-diene?
The IUPAC name of ethane;1-methoxy-4-(trifluoromethyl)cyclohexa-1,3-diene (CID 142183376) is ethane;1-methoxy-4-(trifluoromethyl)cyclohexa-1,3-diene.
What is the SMILES notation for ethane;1-methoxy-4-(trifluoromethyl)cyclohexa-1,3-diene?
The canonical SMILES for ethane;1-methoxy-4-(trifluoromethyl)cyclohexa-1,3-diene is CC.COC1=CC=C(C(F)(F)F)CC1.
What is the InChIKey of ethane;1-methoxy-4-(trifluoromethyl)cyclohexa-1,3-diene?
The InChIKey is COAMBPHVFQHQAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9F3O.C2H6/c1-12-7-4-2-6(3-5-7)8(9,10)11;1-2/h2,4H,3,5H2,1H3;1-2H3.
What are the key properties of ethane;1-methoxy-4-(trifluoromethyl)cyclohexa-1,3-diene?
ethane;1-methoxy-4-(trifluoromethyl)cyclohexa-1,3-diene has a molecular weight of 208.22 g/mol, XLogP of 3.83, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-methoxy-4-(trifluoromethyl)cyclohexa-1,3-diene is sourced from PubChem (CID 142183376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).