C9H10FNO2 — CID 142183569
N-[(1S)-1-(3-fluorophenyl)-2-hydroxyethyl]formamide (PubChem CID 142183569) has the molecular formula C9H10FNO2 and a molecular weight of 183.18 g/mol. Its IUPAC name is N-[(1S)-1-(3-fluorophenyl)-2-hydroxyethyl]formamide.
| Compound Name | N-[(1S)-1-(3-fluorophenyl)-2-hydroxyethyl]formamide |
|---|---|
| PubChem CID | 142183569 |
| Molecular Formula | C9H10FNO2 |
| Molecular Weight | 183.18 g/mol |
| Exact Mass | 183.07 |
| IUPAC Name | N-[(1S)-1-(3-fluorophenyl)-2-hydroxyethyl]formamide |
| SMILES | O=CN[C@H](CO)c1cccc(F)c1 |
| InChI | InChI=1S/C9H10FNO2/c10-8-3-1-2-7(4-8)9(5-12)11-6-13/h1-4,6,9,12H,5H2,(H,11,13)/t9-/m1/s1 |
| InChIKey | ADSFAESPQBEEQR-SECBINFHSA-N |
| XLogP | 0.61 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.18 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|