C10H13NO2S — CID 142183585
[(1S)-3-hydroxy-1-phenylpropyl]carbamothioic S-acid (PubChem CID 142183585) has the molecular formula C10H13NO2S and a molecular weight of 211.29 g/mol. Its IUPAC name is [(1S)-3-hydroxy-1-phenylpropyl]carbamothioic S-acid.
| Compound Name | [(1S)-3-hydroxy-1-phenylpropyl]carbamothioic S-acid |
|---|---|
| PubChem CID | 142183585 |
| Molecular Formula | C10H13NO2S |
| Molecular Weight | 211.29 g/mol |
| Exact Mass | 211.07 |
| IUPAC Name | [(1S)-3-hydroxy-1-phenylpropyl]carbamothioic S-acid |
| SMILES | O=C(S)N[C@@H](CCO)c1ccccc1 |
| InChI | InChI=1S/C10H13NO2S/c12-7-6-9(11-10(13)14)8-4-2-1-3-5-8/h1-5,9,12H,6-7H2,(H2,11,13,14)/t9-/m0/s1 |
| InChIKey | JWRUJKQOLPHTTF-VIFPVBQESA-N |
| XLogP | 1.75 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.29 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|