About 4-N,4-N-dimethyl-9H-benzo[7]annulene-1,4-diamine
4-N,4-N-dimethyl-9H-benzo[7]annulene-1,4-diamine (PubChem CID 142183863) has the molecular formula C13H16N2
and a molecular weight of 200.28 g/mol. Its IUPAC name is 4-N,4-N-dimethyl-9H-benzo[7]annulene-1,4-diamine.
Molecular Properties
| Compound Name | 4-N,4-N-dimethyl-9H-benzo[7]annulene-1,4-diamine |
| PubChem CID | 142183863 |
| Molecular Formula | C13H16N2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | 4-N,4-N-dimethyl-9H-benzo[7]annulene-1,4-diamine |
| SMILES | CN(C)c1ccc(N)c2c1C=CC=CC2 |
| InChI | InChI=1S/C13H16N2/c1-15(2)13-9-8-12(14)10-6-4-3-5-7-11(10)13/h3-5,7-9H,6,14H2,1-2H3 |
| InChIKey | CUVHMBSKUFLAGE-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-N,4-N-dimethyl-9H-benzo[7]annulene-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N,4-N-dimethyl-9H-benzo[7]annulene-1,4-diamine?
The IUPAC name of 4-N,4-N-dimethyl-9H-benzo[7]annulene-1,4-diamine (CID 142183863) is 4-N,4-N-dimethyl-9H-benzo[7]annulene-1,4-diamine.
What is the SMILES notation for 4-N,4-N-dimethyl-9H-benzo[7]annulene-1,4-diamine?
The canonical SMILES for 4-N,4-N-dimethyl-9H-benzo[7]annulene-1,4-diamine is CN(C)c1ccc(N)c2c1C=CC=CC2.
What is the InChIKey of 4-N,4-N-dimethyl-9H-benzo[7]annulene-1,4-diamine?
The InChIKey is CUVHMBSKUFLAGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2/c1-15(2)13-9-8-12(14)10-6-4-3-5-7-11(10)13/h3-5,7-9H,6,14H2,1-2H3.
What are the key properties of 4-N,4-N-dimethyl-9H-benzo[7]annulene-1,4-diamine?
4-N,4-N-dimethyl-9H-benzo[7]annulene-1,4-diamine has a molecular weight of 200.28 g/mol, XLogP of 2.46, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N,4-N-dimethyl-9H-benzo[7]annulene-1,4-diamine is sourced from PubChem (CID 142183863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).