C23H28N4O9S — CID 142184607
N-[1-(6,8-dimethoxy-1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-1-oxopentan-2-yl]-2,4-dinitrobenzenesulfonamide (PubChem CID 142184607) has the molecular formula C23H28N4O9S and a molecular weight of 536.56 g/mol. Its IUPAC name is N-[1-(6,8-dimethoxy-1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-1-oxopentan-2-yl]-2,4-dinitrobenzenesulfonamide.
| Compound Name | N-[1-(6,8-dimethoxy-1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-1-oxopentan-2-yl]-2,4-dinitrobenzenesulfonamide |
|---|---|
| PubChem CID | 142184607 |
| Molecular Formula | C23H28N4O9S |
| Molecular Weight | 536.56 g/mol |
| Exact Mass | 536.16 |
| IUPAC Name | N-[1-(6,8-dimethoxy-1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-1-oxopentan-2-yl]-2,4-dinitrobenzenesulfonamide |
| SMILES | CCCC(NS(=O)(=O)c1ccc([N+](=O)[O-])cc1[N+](=O)[O-])C(=O)N1CCc2cc(OC)cc(OC)c2C1C |
| InChI | InChI=1S/C23H28N4O9S/c1-5-6-18(24-37(33,34)21-8-7-16(26(29)30)12-19(21)27(31)32)23(28)25-10-9-15-11-17(35-3)13-20(36-4)22(15)14(25)2/h7-8,11-14,18,24H,5-6,9-10H2,1-4H3 |
| InChIKey | ZGFPVSLOQRWOLE-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 171.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.56 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|