C23H29N3O4 — CID 142184639
1-(5-methoxy-11-oxo-10,17-diazatetracyclo[10.3.2.01,10.02,7]heptadeca-2(7),3,5-trien-17-yl)-2-piperidin-1-ylethane-1,2-dione (PubChem CID 142184639) has the molecular formula C23H29N3O4 and a molecular weight of 411.50 g/mol. Its IUPAC name is 1-(5-methoxy-11-oxo-10,17-diazatetracyclo[10.3.2.01,10.02,7]heptadeca-2(7),3,5-trien-17-yl)-2-piperidin-1-ylethane-1,2-dione.
| Compound Name | 1-(5-methoxy-11-oxo-10,17-diazatetracyclo[10.3.2.01,10.02,7]heptadeca-2(7),3,5-trien-17-yl)-2-piperidin-1-ylethane-1,2-dione |
|---|---|
| PubChem CID | 142184639 |
| Molecular Formula | C23H29N3O4 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | 1-(5-methoxy-11-oxo-10,17-diazatetracyclo[10.3.2.01,10.02,7]heptadeca-2(7),3,5-trien-17-yl)-2-piperidin-1-ylethane-1,2-dione |
| SMILES | COc1ccc2c(c1)CCN1C(=O)C3CCCC21CN3C(=O)C(=O)N1CCCCC1 |
| InChI | InChI=1S/C23H29N3O4/c1-30-17-7-8-18-16(14-17)9-13-26-20(27)19-6-5-10-23(18,26)15-25(19)22(29)21(28)24-11-3-2-4-12-24/h7-8,14,19H,2-6,9-13,15H2,1H3 |
| InChIKey | JIDIQTIRXOFSDR-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|