C27H27N3O4S — CID 142184761
(1R,2R,10S)-10-methyl-17-(4-pyridin-4-yloxyphenyl)sulfonyl-11,17-diazatetracyclo[11.3.1.02,11.03,8]heptadeca-3,5,7-trien-12-one (PubChem CID 142184761) has the molecular formula C27H27N3O4S and a molecular weight of 489.60 g/mol. Its IUPAC name is (1R,2R,10S)-10-methyl-17-(4-pyridin-4-yloxyphenyl)sulfonyl-11,17-diazatetracyclo[11.3.1.02,11.03,8]heptadeca-3,5,7-trien-12-one.
| Compound Name | (1R,2R,10S)-10-methyl-17-(4-pyridin-4-yloxyphenyl)sulfonyl-11,17-diazatetracyclo[11.3.1.02,11.03,8]heptadeca-3,5,7-trien-12-one |
|---|---|
| PubChem CID | 142184761 |
| Molecular Formula | C27H27N3O4S |
| Molecular Weight | 489.60 g/mol |
| Exact Mass | 489.17 |
| IUPAC Name | (1R,2R,10S)-10-methyl-17-(4-pyridin-4-yloxyphenyl)sulfonyl-11,17-diazatetracyclo[11.3.1.02,11.03,8]heptadeca-3,5,7-trien-12-one |
| SMILES | C[C@H]1Cc2ccccc2[C@@H]2[C@H]3CCCC(C(=O)N21)N3S(=O)(=O)c1ccc(Oc2ccncc2)cc1 |
| InChI | InChI=1S/C27H27N3O4S/c1-18-17-19-5-2-3-6-23(19)26-24-7-4-8-25(27(31)29(18)26)30(24)35(32,33)22-11-9-20(10-12-22)34-21-13-15-28-16-14-21/h2-3,5-6,9-16,18,24-26H,4,7-8,17H2,1H3/t18-,24+,25?,26+/m0/s1 |
| InChIKey | PNPPCNKAEBIFER-HGCPJYIHSA-N |
| XLogP | 4.31 |
| TPSA | 79.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.60 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |