C13H23N — CID 142185116
ethane;N-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]propan-2-imine (PubChem CID 142185116) has the molecular formula C13H23N and a molecular weight of 193.33 g/mol. Its IUPAC name is ethane;N-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]propan-2-imine.
| Compound Name | ethane;N-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]propan-2-imine |
|---|---|
| PubChem CID | 142185116 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | ethane;N-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]propan-2-imine |
| SMILES | C/C=C\C=C(/C=C\C)N=C(C)C.CC |
| InChI | InChI=1S/C11H17N.C2H6/c1-5-7-9-11(8-6-2)12-10(3)4;1-2/h5-9H,1-4H3;1-2H3/b7-5-,8-6-,11-9+; |
| InChIKey | STVPCKINCVRCRC-FUOSITBXSA-N |
| XLogP | 4.53 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|