C8H10Cl2S — CID 142185313
(1E,3E,5E)-1,3-dichloro-6-methylsulfanylhepta-1,3,5-triene (PubChem CID 142185313) has the molecular formula C8H10Cl2S and a molecular weight of 209.14 g/mol. Its IUPAC name is (1E,3E,5E)-1,3-dichloro-6-methylsulfanylhepta-1,3,5-triene.
| Compound Name | (1E,3E,5E)-1,3-dichloro-6-methylsulfanylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 142185313 |
| Molecular Formula | C8H10Cl2S |
| Molecular Weight | 209.14 g/mol |
| Exact Mass | 207.99 |
| IUPAC Name | (1E,3E,5E)-1,3-dichloro-6-methylsulfanylhepta-1,3,5-triene |
| SMILES | CS/C(C)=C/C=C(Cl)\C=C\Cl |
| InChI | InChI=1S/C8H10Cl2S/c1-7(11-2)3-4-8(10)5-6-9/h3-6H,1-2H3/b6-5+,7-3+,8-4+ |
| InChIKey | GRMSPERZSHNVHP-PTKURJLQSA-N |
| XLogP | 4.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.14 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|