C24H33N3O6S — CID 142186257
4-[4-[3-(3-cyclohexyl-2,5-dioxoimidazolidin-1-yl)propoxy]phenyl]sulfinyloxane-4-carboxamide (PubChem CID 142186257) has the molecular formula C24H33N3O6S and a molecular weight of 491.61 g/mol. Its IUPAC name is 4-[4-[3-(3-cyclohexyl-2,5-dioxoimidazolidin-1-yl)propoxy]phenyl]sulfinyloxane-4-carboxamide.
| Compound Name | 4-[4-[3-(3-cyclohexyl-2,5-dioxoimidazolidin-1-yl)propoxy]phenyl]sulfinyloxane-4-carboxamide |
|---|---|
| PubChem CID | 142186257 |
| Molecular Formula | C24H33N3O6S |
| Molecular Weight | 491.61 g/mol |
| Exact Mass | 491.21 |
| IUPAC Name | 4-[4-[3-(3-cyclohexyl-2,5-dioxoimidazolidin-1-yl)propoxy]phenyl]sulfinyloxane-4-carboxamide |
| SMILES | NC(=O)C1(S(=O)c2ccc(OCCCN3C(=O)CN(C4CCCCC4)C3=O)cc2)CCOCC1 |
| InChI | InChI=1S/C24H33N3O6S/c25-22(29)24(11-15-32-16-12-24)34(31)20-9-7-19(8-10-20)33-14-4-13-26-21(28)17-27(23(26)30)18-5-2-1-3-6-18/h7-10,18H,1-6,11-17H2,(H2,25,29) |
| InChIKey | LHNPZSOILYXVOL-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 119.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.61 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|