C25H27ClFNO2S2 — CID 142186799
2-[4-[(E)-but-2-en-2-yl]sulfanyl-7-fluoro-5-thiophen-3-yl-2,3-dihydro-1H-pyrrolo[1,2-a]indol-3-yl]acetic acid;(Z)-1-chlorobut-2-ene (PubChem CID 142186799) has the molecular formula C25H27ClFNO2S2 and a molecular weight of 492.08 g/mol. Its IUPAC name is 2-[4-[(E)-but-2-en-2-yl]sulfanyl-7-fluoro-5-thiophen-3-yl-2,3-dihydro-1H-pyrrolo[1,2-a]indol-3-yl]acetic acid;(Z)-1-chlorobut-2-ene.
| Compound Name | 2-[4-[(E)-but-2-en-2-yl]sulfanyl-7-fluoro-5-thiophen-3-yl-2,3-dihydro-1H-pyrrolo[1,2-a]indol-3-yl]acetic acid;(Z)-1-chlorobut-2-ene |
|---|---|
| PubChem CID | 142186799 |
| Molecular Formula | C25H27ClFNO2S2 |
| Molecular Weight | 492.08 g/mol |
| Exact Mass | 491.12 |
| IUPAC Name | 2-[4-[(E)-but-2-en-2-yl]sulfanyl-7-fluoro-5-thiophen-3-yl-2,3-dihydro-1H-pyrrolo[1,2-a]indol-3-yl]acetic acid;(Z)-1-chlorobut-2-ene |
| SMILES | C/C=C(\C)Sc1c2n(c3cc(F)cc(-c4ccsc4)c13)CCC2CC(=O)O.C/C=C\CCl |
| InChI | InChI=1S/C21H20FNO2S2.C4H7Cl/c1-3-12(2)27-21-19-16(14-5-7-26-11-14)9-15(22)10-17(19)23-6-4-13(20(21)23)8-18(24)25;1-2-3-4-5/h3,5,7,9-11,13H,4,6,8H2,1-2H3,(H,24,25);2-3H,4H2,1H3/b12-3+;3-2- |
| InChIKey | XDRUDJOPRKNILZ-WNCIMTELSA-N |
| XLogP | 8.29 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.08 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|