C21H37N3 — CID 142187221
1-[(2E,5Z)-4-methylidenehepta-2,5-dien-2-yl]-4-(4-piperidin-1-ylbutyl)piperazine (PubChem CID 142187221) has the molecular formula C21H37N3 and a molecular weight of 331.55 g/mol. Its IUPAC name is 1-[(2E,5Z)-4-methylidenehepta-2,5-dien-2-yl]-4-(4-piperidin-1-ylbutyl)piperazine.
| Compound Name | 1-[(2E,5Z)-4-methylidenehepta-2,5-dien-2-yl]-4-(4-piperidin-1-ylbutyl)piperazine |
|---|---|
| PubChem CID | 142187221 |
| Molecular Formula | C21H37N3 |
| Molecular Weight | 331.55 g/mol |
| Exact Mass | 331.30 |
| IUPAC Name | 1-[(2E,5Z)-4-methylidenehepta-2,5-dien-2-yl]-4-(4-piperidin-1-ylbutyl)piperazine |
| SMILES | C=C(/C=C\C)/C=C(\C)N1CCN(CCCCN2CCCCC2)CC1 |
| InChI | InChI=1S/C21H37N3/c1-4-10-20(2)19-21(3)24-17-15-23(16-18-24)14-9-8-13-22-11-6-5-7-12-22/h4,10,19H,2,5-9,11-18H2,1,3H3/b10-4-,21-19+ |
| InChIKey | CQVWBTJWLGQEMN-UYOCFIJVSA-N |
| XLogP | 3.91 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.55 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|