C12H24N2O2 — CID 142187713
4,6-dimethyl-4a,5,7,8,9,9a-hexahydro-[1,4]oxazino[3,2-c]azepin-3-one;ethane (PubChem CID 142187713) has the molecular formula C12H24N2O2 and a molecular weight of 228.34 g/mol. Its IUPAC name is 4,6-dimethyl-4a,5,7,8,9,9a-hexahydro-[1,4]oxazino[3,2-c]azepin-3-one;ethane.
| Compound Name | 4,6-dimethyl-4a,5,7,8,9,9a-hexahydro-[1,4]oxazino[3,2-c]azepin-3-one;ethane |
|---|---|
| PubChem CID | 142187713 |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.18 |
| IUPAC Name | 4,6-dimethyl-4a,5,7,8,9,9a-hexahydro-[1,4]oxazino[3,2-c]azepin-3-one;ethane |
| SMILES | CC.CN1CCCC2OCC(=O)N(C)C2C1 |
| InChI | InChI=1S/C10H18N2O2.C2H6/c1-11-5-3-4-9-8(6-11)12(2)10(13)7-14-9;1-2/h8-9H,3-7H2,1-2H3;1-2H3 |
| InChIKey | QPVIVCDGOADWHK-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |