About 3,4-dimethylcyclohexan-1-one;ethane
3,4-dimethylcyclohexan-1-one;ethane (PubChem CID 142187716) has the molecular formula C12H26O
and a molecular weight of 186.34 g/mol. Its IUPAC name is 3,4-dimethylcyclohexan-1-one;ethane.
Molecular Properties
| Compound Name | 3,4-dimethylcyclohexan-1-one;ethane |
| PubChem CID | 142187716 |
| Molecular Formula | C12H26O |
| Molecular Weight | 186.34 g/mol |
| Exact Mass | 186.20 |
| IUPAC Name | 3,4-dimethylcyclohexan-1-one;ethane |
| SMILES | CC.CC.CC1CCC(=O)CC1C |
| InChI | InChI=1S/C8H14O.2C2H6/c1-6-3-4-8(9)5-7(6)2;2*1-2/h6-7H,3-5H2,1-2H3;2*1-2H3 |
| InChIKey | GAOXPKLSBGZVNB-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.34 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,4-dimethylcyclohexan-1-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dimethylcyclohexan-1-one;ethane?
The IUPAC name of 3,4-dimethylcyclohexan-1-one;ethane (CID 142187716) is 3,4-dimethylcyclohexan-1-one;ethane.
What is the SMILES notation for 3,4-dimethylcyclohexan-1-one;ethane?
The canonical SMILES for 3,4-dimethylcyclohexan-1-one;ethane is CC.CC.CC1CCC(=O)CC1C.
What is the InChIKey of 3,4-dimethylcyclohexan-1-one;ethane?
The InChIKey is GAOXPKLSBGZVNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O.2C2H6/c1-6-3-4-8(9)5-7(6)2;2*1-2/h6-7H,3-5H2,1-2H3;2*1-2H3.
What are the key properties of 3,4-dimethylcyclohexan-1-one;ethane?
3,4-dimethylcyclohexan-1-one;ethane has a molecular weight of 186.34 g/mol, XLogP of 4.06, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethylcyclohexan-1-one;ethane is sourced from PubChem (CID 142187716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).