C9H12N3O3P — CID 142187773
N-[(Z)-2-(3-methyl-5,7-dioxo-4-phosphanyl-1H-1,4-diazepin-2-yl)ethenyl]formamide (PubChem CID 142187773) has the molecular formula C9H12N3O3P and a molecular weight of 241.19 g/mol. Its IUPAC name is N-[(Z)-2-(3-methyl-5,7-dioxo-4-phosphanyl-1H-1,4-diazepin-2-yl)ethenyl]formamide.
| Compound Name | N-[(Z)-2-(3-methyl-5,7-dioxo-4-phosphanyl-1H-1,4-diazepin-2-yl)ethenyl]formamide |
|---|---|
| PubChem CID | 142187773 |
| Molecular Formula | C9H12N3O3P |
| Molecular Weight | 241.19 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | N-[(Z)-2-(3-methyl-5,7-dioxo-4-phosphanyl-1H-1,4-diazepin-2-yl)ethenyl]formamide |
| SMILES | CC1=C(/C=C\NC=O)NC(=O)CC(=O)N1P |
| InChI | InChI=1S/C9H12N3O3P/c1-6-7(2-3-10-5-13)11-8(14)4-9(15)12(6)16/h2-3,5H,4,16H2,1H3,(H,10,13)(H,11,14)/b3-2- |
| InChIKey | VVLXLKDOTBYPHL-IHWYPQMZSA-N |
| XLogP | -0.38 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.19 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|