C12H24N2O — CID 142187811
1,7-dimethyl-3,4a,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-4-one;ethane (PubChem CID 142187811) has the molecular formula C12H24N2O and a molecular weight of 212.34 g/mol. Its IUPAC name is 1,7-dimethyl-3,4a,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-4-one;ethane.
| Compound Name | 1,7-dimethyl-3,4a,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-4-one;ethane |
|---|---|
| PubChem CID | 142187811 |
| Molecular Formula | C12H24N2O |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.19 |
| IUPAC Name | 1,7-dimethyl-3,4a,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-4-one;ethane |
| SMILES | CC.CN1CCC2C(=O)CCN(C)C2C1 |
| InChI | InChI=1S/C10H18N2O.C2H6/c1-11-5-3-8-9(7-11)12(2)6-4-10(8)13;1-2/h8-9H,3-7H2,1-2H3;1-2H3 |
| InChIKey | UAVPTLBQRQUTPZ-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |