About 1-[(2Z)-2-methylsulfanylpenta-2,4-dienyl]piperazine
1-[(2Z)-2-methylsulfanylpenta-2,4-dienyl]piperazine (PubChem CID 142187961) has the molecular formula C10H18N2S
and a molecular weight of 198.33 g/mol. Its IUPAC name is 1-[(2Z)-2-methylsulfanylpenta-2,4-dienyl]piperazine.
Molecular Properties
| Compound Name | 1-[(2Z)-2-methylsulfanylpenta-2,4-dienyl]piperazine |
| PubChem CID | 142187961 |
| Molecular Formula | C10H18N2S |
| Molecular Weight | 198.33 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | 1-[(2Z)-2-methylsulfanylpenta-2,4-dienyl]piperazine |
| SMILES | C=C/C=C(/CN1CCNCC1)SC |
| InChI | InChI=1S/C10H18N2S/c1-3-4-10(13-2)9-12-7-5-11-6-8-12/h3-4,11H,1,5-9H2,2H3/b10-4- |
| InChIKey | VESZCXYDEMFRLR-WMZJFQQLSA-N |
| XLogP | 1.32 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.33 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2Z)-2-methylsulfanylpenta-2,4-dienyl]piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2Z)-2-methylsulfanylpenta-2,4-dienyl]piperazine?
The IUPAC name of 1-[(2Z)-2-methylsulfanylpenta-2,4-dienyl]piperazine (CID 142187961) is 1-[(2Z)-2-methylsulfanylpenta-2,4-dienyl]piperazine.
What is the SMILES notation for 1-[(2Z)-2-methylsulfanylpenta-2,4-dienyl]piperazine?
The canonical SMILES for 1-[(2Z)-2-methylsulfanylpenta-2,4-dienyl]piperazine is C=C/C=C(/CN1CCNCC1)SC.
What is the InChIKey of 1-[(2Z)-2-methylsulfanylpenta-2,4-dienyl]piperazine?
The InChIKey is VESZCXYDEMFRLR-WMZJFQQLSA-N. The full InChI is InChI=1S/C10H18N2S/c1-3-4-10(13-2)9-12-7-5-11-6-8-12/h3-4,11H,1,5-9H2,2H3/b10-4-.
What are the key properties of 1-[(2Z)-2-methylsulfanylpenta-2,4-dienyl]piperazine?
1-[(2Z)-2-methylsulfanylpenta-2,4-dienyl]piperazine has a molecular weight of 198.33 g/mol, XLogP of 1.32, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2Z)-2-methylsulfanylpenta-2,4-dienyl]piperazine is sourced from PubChem (CID 142187961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).