C22H21F3N4O5 — CID 142187997
aminomethyl 4-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxo-1-(2,2,2-trifluoroethyl)quinoline-3-carboxylate (PubChem CID 142187997) has the molecular formula C22H21F3N4O5 and a molecular weight of 478.43 g/mol. Its IUPAC name is aminomethyl 4-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxo-1-(2,2,2-trifluoroethyl)quinoline-3-carboxylate.
| Compound Name | aminomethyl 4-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxo-1-(2,2,2-trifluoroethyl)quinoline-3-carboxylate |
|---|---|
| PubChem CID | 142187997 |
| Molecular Formula | C22H21F3N4O5 |
| Molecular Weight | 478.43 g/mol |
| Exact Mass | 478.15 |
| IUPAC Name | aminomethyl 4-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxo-1-(2,2,2-trifluoroethyl)quinoline-3-carboxylate |
| SMILES | NCOC(=O)c1c(N2CCN(C(=O)c3ccco3)CC2)c2ccccc2n(CC(F)(F)F)c1=O |
| InChI | InChI=1S/C22H21F3N4O5/c23-22(24,25)12-29-15-5-2-1-4-14(15)18(17(20(29)31)21(32)34-13-26)27-7-9-28(10-8-27)19(30)16-6-3-11-33-16/h1-6,11H,7-10,12-13,26H2 |
| InChIKey | VACZNFDMEOANEG-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.43 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|