C27H31ClN4O4 — CID 142188077
ethyl 4-[4-(4-chlorobenzoyl)piperazin-1-yl]-1-[3-(methylamino)propyl]-2-oxoquinoline-3-carboxylate (PubChem CID 142188077) has the molecular formula C27H31ClN4O4 and a molecular weight of 511.02 g/mol. Its IUPAC name is ethyl 4-[4-(4-chlorobenzoyl)piperazin-1-yl]-1-[3-(methylamino)propyl]-2-oxoquinoline-3-carboxylate.
| Compound Name | ethyl 4-[4-(4-chlorobenzoyl)piperazin-1-yl]-1-[3-(methylamino)propyl]-2-oxoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 142188077 |
| Molecular Formula | C27H31ClN4O4 |
| Molecular Weight | 511.02 g/mol |
| Exact Mass | 510.20 |
| IUPAC Name | ethyl 4-[4-(4-chlorobenzoyl)piperazin-1-yl]-1-[3-(methylamino)propyl]-2-oxoquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1c(N2CCN(C(=O)c3ccc(Cl)cc3)CC2)c2ccccc2n(CCCNC)c1=O |
| InChI | InChI=1S/C27H31ClN4O4/c1-3-36-27(35)23-24(21-7-4-5-8-22(21)32(26(23)34)14-6-13-29-2)30-15-17-31(18-16-30)25(33)19-9-11-20(28)12-10-19/h4-5,7-12,29H,3,6,13-18H2,1-2H3 |
| InChIKey | XTIGTNBPSCPJPU-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 83.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.02 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|