C25H27BrF2N4O3S — CID 142188373
(2R)-2-[[5-bromo-2-[3-[2-[[4-(1,1-difluoroethyl)phenyl]methyl]prop-2-enylsulfonyl]anilino]pyrimidin-4-yl]amino]propan-1-ol (PubChem CID 142188373) has the molecular formula C25H27BrF2N4O3S and a molecular weight of 581.48 g/mol. Its IUPAC name is (2R)-2-[[5-bromo-2-[3-[2-[[4-(1,1-difluoroethyl)phenyl]methyl]prop-2-enylsulfonyl]anilino]pyrimidin-4-yl]amino]propan-1-ol.
| Compound Name | (2R)-2-[[5-bromo-2-[3-[2-[[4-(1,1-difluoroethyl)phenyl]methyl]prop-2-enylsulfonyl]anilino]pyrimidin-4-yl]amino]propan-1-ol |
|---|---|
| PubChem CID | 142188373 |
| Molecular Formula | C25H27BrF2N4O3S |
| Molecular Weight | 581.48 g/mol |
| Exact Mass | 580.10 |
| IUPAC Name | (2R)-2-[[5-bromo-2-[3-[2-[[4-(1,1-difluoroethyl)phenyl]methyl]prop-2-enylsulfonyl]anilino]pyrimidin-4-yl]amino]propan-1-ol |
| SMILES | C=C(Cc1ccc(C(C)(F)F)cc1)CS(=O)(=O)c1cccc(Nc2ncc(Br)c(N[C@H](C)CO)n2)c1 |
| InChI | InChI=1S/C25H27BrF2N4O3S/c1-16(11-18-7-9-19(10-8-18)25(3,27)28)15-36(34,35)21-6-4-5-20(12-21)31-24-29-13-22(26)23(32-24)30-17(2)14-33/h4-10,12-13,17,33H,1,11,14-15H2,2-3H3,(H2,29,30,31,32)/t17-/m1/s1 |
| InChIKey | FRNRFRQWXSXOFF-QGZVFWFLSA-N |
| XLogP | 5.46 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.48 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|