About ethane;6-[(3Z,4Z)-3-ethylidenehepta-4,6-dienyl]-1-oxa-6-azaspiro[2.5]octane
ethane;6-[(3Z,4Z)-3-ethylidenehepta-4,6-dienyl]-1-oxa-6-azaspiro[2.5]octane (PubChem CID 142188864) has the molecular formula C17H29NO
and a molecular weight of 263.43 g/mol. Its IUPAC name is ethane;6-[(3Z,4Z)-3-ethylidenehepta-4,6-dienyl]-1-oxa-6-azaspiro[2.5]octane.
Molecular Properties
| Compound Name | ethane;6-[(3Z,4Z)-3-ethylidenehepta-4,6-dienyl]-1-oxa-6-azaspiro[2.5]octane |
| PubChem CID | 142188864 |
| Molecular Formula | C17H29NO |
| Molecular Weight | 263.43 g/mol |
| Exact Mass | 263.22 |
| IUPAC Name | ethane;6-[(3Z,4Z)-3-ethylidenehepta-4,6-dienyl]-1-oxa-6-azaspiro[2.5]octane |
| SMILES | C=C/C=C\C(=C/C)CCN1CCC2(CC1)CO2.CC |
| InChI | InChI=1S/C15H23NO.C2H6/c1-3-5-6-14(4-2)7-10-16-11-8-15(9-12-16)13-17-15;1-2/h3-6H,1,7-13H2,2H3;1-2H3/b6-5-,14-4+; |
| InChIKey | MUKCGJSLJJAICR-NHRISWHCSA-N |
| XLogP | 3.96 |
| TPSA | 15.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.43 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze ethane;6-[(3Z,4Z)-3-ethylidenehepta-4,6-dienyl]-1-oxa-6-azaspiro[2.5]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;6-[(3Z,4Z)-3-ethylidenehepta-4,6-dienyl]-1-oxa-6-azaspiro[2.5]octane?
The IUPAC name of ethane;6-[(3Z,4Z)-3-ethylidenehepta-4,6-dienyl]-1-oxa-6-azaspiro[2.5]octane (CID 142188864) is ethane;6-[(3Z,4Z)-3-ethylidenehepta-4,6-dienyl]-1-oxa-6-azaspiro[2.5]octane.
What is the SMILES notation for ethane;6-[(3Z,4Z)-3-ethylidenehepta-4,6-dienyl]-1-oxa-6-azaspiro[2.5]octane?
The canonical SMILES for ethane;6-[(3Z,4Z)-3-ethylidenehepta-4,6-dienyl]-1-oxa-6-azaspiro[2.5]octane is C=C/C=C\C(=C/C)CCN1CCC2(CC1)CO2.CC.
What is the InChIKey of ethane;6-[(3Z,4Z)-3-ethylidenehepta-4,6-dienyl]-1-oxa-6-azaspiro[2.5]octane?
The InChIKey is MUKCGJSLJJAICR-NHRISWHCSA-N. The full InChI is InChI=1S/C15H23NO.C2H6/c1-3-5-6-14(4-2)7-10-16-11-8-15(9-12-16)13-17-15;1-2/h3-6H,1,7-13H2,2H3;1-2H3/b6-5-,14-4+;.
What are the key properties of ethane;6-[(3Z,4Z)-3-ethylidenehepta-4,6-dienyl]-1-oxa-6-azaspiro[2.5]octane?
ethane;6-[(3Z,4Z)-3-ethylidenehepta-4,6-dienyl]-1-oxa-6-azaspiro[2.5]octane has a molecular weight of 263.43 g/mol, XLogP of 3.96, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;6-[(3Z,4Z)-3-ethylidenehepta-4,6-dienyl]-1-oxa-6-azaspiro[2.5]octane is sourced from PubChem (CID 142188864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).