About 1-fluoro-3-(3-methylphenyl)benzene;methane;2-(2-methyl-4-pyridinyl)-1,3-thiazole
1-fluoro-3-(3-methylphenyl)benzene;methane;2-(2-methyl-4-pyridinyl)-1,3-thiazole (PubChem CID 142189212) has the molecular formula C23H23FN2S
and a molecular weight of 378.52 g/mol. Its IUPAC name is 1-fluoro-3-(3-methylphenyl)benzene;methane;2-(2-methyl-4-pyridinyl)-1,3-thiazole.
Molecular Properties
| Compound Name | 1-fluoro-3-(3-methylphenyl)benzene;methane;2-(2-methyl-4-pyridinyl)-1,3-thiazole |
| PubChem CID | 142189212 |
| Molecular Formula | C23H23FN2S |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | 1-fluoro-3-(3-methylphenyl)benzene;methane;2-(2-methyl-4-pyridinyl)-1,3-thiazole |
| SMILES | C.Cc1cc(-c2nccs2)ccn1.Cc1cccc(-c2cccc(F)c2)c1 |
| InChI | InChI=1S/C13H11F.C9H8N2S.CH4/c1-10-4-2-5-11(8-10)12-6-3-7-13(14)9-12;1-7-6-8(2-3-10-7)9-11-4-5-12-9;/h2-9H,1H3;2-6H,1H3;1H4 |
| InChIKey | COUJXLLWLHWYME-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-fluoro-3-(3-methylphenyl)benzene;methane;2-(2-methyl-4-pyridinyl)-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoro-3-(3-methylphenyl)benzene;methane;2-(2-methyl-4-pyridinyl)-1,3-thiazole?
The IUPAC name of 1-fluoro-3-(3-methylphenyl)benzene;methane;2-(2-methyl-4-pyridinyl)-1,3-thiazole (CID 142189212) is 1-fluoro-3-(3-methylphenyl)benzene;methane;2-(2-methyl-4-pyridinyl)-1,3-thiazole.
What is the SMILES notation for 1-fluoro-3-(3-methylphenyl)benzene;methane;2-(2-methyl-4-pyridinyl)-1,3-thiazole?
The canonical SMILES for 1-fluoro-3-(3-methylphenyl)benzene;methane;2-(2-methyl-4-pyridinyl)-1,3-thiazole is C.Cc1cc(-c2nccs2)ccn1.Cc1cccc(-c2cccc(F)c2)c1.
What is the InChIKey of 1-fluoro-3-(3-methylphenyl)benzene;methane;2-(2-methyl-4-pyridinyl)-1,3-thiazole?
The InChIKey is COUJXLLWLHWYME-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11F.C9H8N2S.CH4/c1-10-4-2-5-11(8-10)12-6-3-7-13(14)9-12;1-7-6-8(2-3-10-7)9-11-4-5-12-9;/h2-9H,1H3;2-6H,1H3;1H4.
What are the key properties of 1-fluoro-3-(3-methylphenyl)benzene;methane;2-(2-methyl-4-pyridinyl)-1,3-thiazole?
1-fluoro-3-(3-methylphenyl)benzene;methane;2-(2-methyl-4-pyridinyl)-1,3-thiazole has a molecular weight of 378.52 g/mol, XLogP of 6.95, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoro-3-(3-methylphenyl)benzene;methane;2-(2-methyl-4-pyridinyl)-1,3-thiazole is sourced from PubChem (CID 142189212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).