C26H26N4O4 — CID 142189229
1-[4-[(2-methylquinolin-4-yl)methoxy]phenyl]-2,4-dioxo-1,3-diazaspiro[4.5]decane-6-carboxamide (PubChem CID 142189229) has the molecular formula C26H26N4O4 and a molecular weight of 458.52 g/mol. Its IUPAC name is 1-[4-[(2-methylquinolin-4-yl)methoxy]phenyl]-2,4-dioxo-1,3-diazaspiro[4.5]decane-6-carboxamide.
| Compound Name | 1-[4-[(2-methylquinolin-4-yl)methoxy]phenyl]-2,4-dioxo-1,3-diazaspiro[4.5]decane-6-carboxamide |
|---|---|
| PubChem CID | 142189229 |
| Molecular Formula | C26H26N4O4 |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | 1-[4-[(2-methylquinolin-4-yl)methoxy]phenyl]-2,4-dioxo-1,3-diazaspiro[4.5]decane-6-carboxamide |
| SMILES | Cc1cc(COc2ccc(N3C(=O)NC(=O)C34CCCCC4C(N)=O)cc2)c2ccccc2n1 |
| InChI | InChI=1S/C26H26N4O4/c1-16-14-17(20-6-2-3-8-22(20)28-16)15-34-19-11-9-18(10-12-19)30-25(33)29-24(32)26(30)13-5-4-7-21(26)23(27)31/h2-3,6,8-12,14,21H,4-5,7,13,15H2,1H3,(H2,27,31)(H,29,32,33) |
| InChIKey | UYGLLBLEBZLBTL-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 114.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|