C23H18F2N2O2S — CID 142189808
5-[(Z)-[5-[(2,4-difluorophenyl)methylsulfanyl]-2-oxo-1H-indol-3-ylidene]methyl]-2,4-dimethyl-1H-pyrrole-3-carbaldehyde (PubChem CID 142189808) has the molecular formula C23H18F2N2O2S and a molecular weight of 424.47 g/mol. Its IUPAC name is 5-[(Z)-[5-[(2,4-difluorophenyl)methylsulfanyl]-2-oxo-1H-indol-3-ylidene]methyl]-2,4-dimethyl-1H-pyrrole-3-carbaldehyde.
| Compound Name | 5-[(Z)-[5-[(2,4-difluorophenyl)methylsulfanyl]-2-oxo-1H-indol-3-ylidene]methyl]-2,4-dimethyl-1H-pyrrole-3-carbaldehyde |
|---|---|
| PubChem CID | 142189808 |
| Molecular Formula | C23H18F2N2O2S |
| Molecular Weight | 424.47 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | 5-[(Z)-[5-[(2,4-difluorophenyl)methylsulfanyl]-2-oxo-1H-indol-3-ylidene]methyl]-2,4-dimethyl-1H-pyrrole-3-carbaldehyde |
| SMILES | Cc1[nH]c(/C=C2\C(=O)Nc3ccc(SCc4ccc(F)cc4F)cc32)c(C)c1C=O |
| InChI | InChI=1S/C23H18F2N2O2S/c1-12-19(10-28)13(2)26-22(12)9-18-17-8-16(5-6-21(17)27-23(18)29)30-11-14-3-4-15(24)7-20(14)25/h3-10,26H,11H2,1-2H3,(H,27,29)/b18-9- |
| InChIKey | OEJFXXDBRWIURI-NVMNQCDNSA-N |
| XLogP | 5.51 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.47 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|