C23H30N4OS — CID 142189882
(3Z)-3-[[4-[[(3S)-3,5-dimethyl-1,4-diazepan-1-yl]methyl]-3,5-dimethyl-1H-pyrrol-2-yl]methylidene]-5-sulfanyl-1H-indol-2-one (PubChem CID 142189882) has the molecular formula C23H30N4OS and a molecular weight of 410.59 g/mol. Its IUPAC name is (3Z)-3-[[4-[[(3S)-3,5-dimethyl-1,4-diazepan-1-yl]methyl]-3,5-dimethyl-1H-pyrrol-2-yl]methylidene]-5-sulfanyl-1H-indol-2-one.
| Compound Name | (3Z)-3-[[4-[[(3S)-3,5-dimethyl-1,4-diazepan-1-yl]methyl]-3,5-dimethyl-1H-pyrrol-2-yl]methylidene]-5-sulfanyl-1H-indol-2-one |
|---|---|
| PubChem CID | 142189882 |
| Molecular Formula | C23H30N4OS |
| Molecular Weight | 410.59 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | (3Z)-3-[[4-[[(3S)-3,5-dimethyl-1,4-diazepan-1-yl]methyl]-3,5-dimethyl-1H-pyrrol-2-yl]methylidene]-5-sulfanyl-1H-indol-2-one |
| SMILES | Cc1[nH]c(/C=C2\C(=O)Nc3ccc(S)cc32)c(C)c1CN1CCC(C)N[C@@H](C)C1 |
| InChI | InChI=1S/C23H30N4OS/c1-13-7-8-27(11-14(2)24-13)12-20-15(3)22(25-16(20)4)10-19-18-9-17(29)5-6-21(18)26-23(19)28/h5-6,9-10,13-14,24-25,29H,7-8,11-12H2,1-4H3,(H,26,28)/b19-10-/t13?,14-/m0/s1 |
| InChIKey | YLIAYCCJKWENEK-FVWOXCMQSA-N |
| XLogP | 3.99 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.59 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|