About 4-(5-methylcyclohepta-1,3,6-trien-1-yl)pyrimidin-2-amine
4-(5-methylcyclohepta-1,3,6-trien-1-yl)pyrimidin-2-amine (PubChem CID 142190083) has the molecular formula C12H13N3
and a molecular weight of 199.26 g/mol. Its IUPAC name is 4-(5-methylcyclohepta-1,3,6-trien-1-yl)pyrimidin-2-amine.
Molecular Properties
| Compound Name | 4-(5-methylcyclohepta-1,3,6-trien-1-yl)pyrimidin-2-amine |
| PubChem CID | 142190083 |
| Molecular Formula | C12H13N3 |
| Molecular Weight | 199.26 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | 4-(5-methylcyclohepta-1,3,6-trien-1-yl)pyrimidin-2-amine |
| SMILES | CC1C=CC=C(c2ccnc(N)n2)C=C1 |
| InChI | InChI=1S/C12H13N3/c1-9-3-2-4-10(6-5-9)11-7-8-14-12(13)15-11/h2-9H,1H3,(H2,13,14,15) |
| InChIKey | FPBBTIWYJKCVCN-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.26 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(5-methylcyclohepta-1,3,6-trien-1-yl)pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-methylcyclohepta-1,3,6-trien-1-yl)pyrimidin-2-amine?
The IUPAC name of 4-(5-methylcyclohepta-1,3,6-trien-1-yl)pyrimidin-2-amine (CID 142190083) is 4-(5-methylcyclohepta-1,3,6-trien-1-yl)pyrimidin-2-amine.
What is the SMILES notation for 4-(5-methylcyclohepta-1,3,6-trien-1-yl)pyrimidin-2-amine?
The canonical SMILES for 4-(5-methylcyclohepta-1,3,6-trien-1-yl)pyrimidin-2-amine is CC1C=CC=C(c2ccnc(N)n2)C=C1.
What is the InChIKey of 4-(5-methylcyclohepta-1,3,6-trien-1-yl)pyrimidin-2-amine?
The InChIKey is FPBBTIWYJKCVCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N3/c1-9-3-2-4-10(6-5-9)11-7-8-14-12(13)15-11/h2-9H,1H3,(H2,13,14,15).
What are the key properties of 4-(5-methylcyclohepta-1,3,6-trien-1-yl)pyrimidin-2-amine?
4-(5-methylcyclohepta-1,3,6-trien-1-yl)pyrimidin-2-amine has a molecular weight of 199.26 g/mol, XLogP of 2.20, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-methylcyclohepta-1,3,6-trien-1-yl)pyrimidin-2-amine is sourced from PubChem (CID 142190083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).