C23H28F2N2O — CID 142190208
(3E)-4-(2,6-difluorophenyl)-N-[1-(5-morpholin-4-ylcyclohexa-1,5-dien-1-yl)propyl]buta-1,3-dien-2-amine (PubChem CID 142190208) has the molecular formula C23H28F2N2O and a molecular weight of 386.49 g/mol. Its IUPAC name is (3E)-4-(2,6-difluorophenyl)-N-[1-(5-morpholin-4-ylcyclohexa-1,5-dien-1-yl)propyl]buta-1,3-dien-2-amine.
| Compound Name | (3E)-4-(2,6-difluorophenyl)-N-[1-(5-morpholin-4-ylcyclohexa-1,5-dien-1-yl)propyl]buta-1,3-dien-2-amine |
|---|---|
| PubChem CID | 142190208 |
| Molecular Formula | C23H28F2N2O |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | (3E)-4-(2,6-difluorophenyl)-N-[1-(5-morpholin-4-ylcyclohexa-1,5-dien-1-yl)propyl]buta-1,3-dien-2-amine |
| SMILES | C=C(/C=C/c1c(F)cccc1F)NC(CC)C1=CCCC(N2CCOCC2)=C1 |
| InChI | InChI=1S/C23H28F2N2O/c1-3-23(18-6-4-7-19(16-18)27-12-14-28-15-13-27)26-17(2)10-11-20-21(24)8-5-9-22(20)25/h5-6,8-11,16,23,26H,2-4,7,12-15H2,1H3/b11-10+ |
| InChIKey | GNBXGQSMVIHJJZ-ZHACJKMWSA-N |
| XLogP | 4.80 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|