About azane;(3E)-4-(2-fluorophenyl)-N-[(3-pyridin-2-ylphenyl)methyl]buta-1,3-dien-2-amine
azane;(3E)-4-(2-fluorophenyl)-N-[(3-pyridin-2-ylphenyl)methyl]buta-1,3-dien-2-amine (PubChem CID 142190252) has the molecular formula C22H22FN3
and a molecular weight of 347.44 g/mol. Its IUPAC name is azane;(3E)-4-(2-fluorophenyl)-N-[(3-pyridin-2-ylphenyl)methyl]buta-1,3-dien-2-amine.
Molecular Properties
| Compound Name | azane;(3E)-4-(2-fluorophenyl)-N-[(3-pyridin-2-ylphenyl)methyl]buta-1,3-dien-2-amine |
| PubChem CID | 142190252 |
| Molecular Formula | C22H22FN3 |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | azane;(3E)-4-(2-fluorophenyl)-N-[(3-pyridin-2-ylphenyl)methyl]buta-1,3-dien-2-amine |
| SMILES | C=C(/C=C/c1ccccc1F)NCc1cccc(-c2ccccn2)c1.N |
| InChI | InChI=1S/C22H19FN2.H3N/c1-17(12-13-19-8-2-3-10-21(19)23)25-16-18-7-6-9-20(15-18)22-11-4-5-14-24-22;/h2-15,25H,1,16H2;1H3/b13-12+; |
| InChIKey | IHBXXGCPYAMUSR-UEIGIMKUSA-N |
| XLogP | 5.37 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze azane;(3E)-4-(2-fluorophenyl)-N-[(3-pyridin-2-ylphenyl)methyl]buta-1,3-dien-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;(3E)-4-(2-fluorophenyl)-N-[(3-pyridin-2-ylphenyl)methyl]buta-1,3-dien-2-amine?
The IUPAC name of azane;(3E)-4-(2-fluorophenyl)-N-[(3-pyridin-2-ylphenyl)methyl]buta-1,3-dien-2-amine (CID 142190252) is azane;(3E)-4-(2-fluorophenyl)-N-[(3-pyridin-2-ylphenyl)methyl]buta-1,3-dien-2-amine.
What is the SMILES notation for azane;(3E)-4-(2-fluorophenyl)-N-[(3-pyridin-2-ylphenyl)methyl]buta-1,3-dien-2-amine?
The canonical SMILES for azane;(3E)-4-(2-fluorophenyl)-N-[(3-pyridin-2-ylphenyl)methyl]buta-1,3-dien-2-amine is C=C(/C=C/c1ccccc1F)NCc1cccc(-c2ccccn2)c1.N.
What is the InChIKey of azane;(3E)-4-(2-fluorophenyl)-N-[(3-pyridin-2-ylphenyl)methyl]buta-1,3-dien-2-amine?
The InChIKey is IHBXXGCPYAMUSR-UEIGIMKUSA-N. The full InChI is InChI=1S/C22H19FN2.H3N/c1-17(12-13-19-8-2-3-10-21(19)23)25-16-18-7-6-9-20(15-18)22-11-4-5-14-24-22;/h2-15,25H,1,16H2;1H3/b13-12+;.
What are the key properties of azane;(3E)-4-(2-fluorophenyl)-N-[(3-pyridin-2-ylphenyl)methyl]buta-1,3-dien-2-amine?
azane;(3E)-4-(2-fluorophenyl)-N-[(3-pyridin-2-ylphenyl)methyl]buta-1,3-dien-2-amine has a molecular weight of 347.44 g/mol, XLogP of 5.37, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;(3E)-4-(2-fluorophenyl)-N-[(3-pyridin-2-ylphenyl)methyl]buta-1,3-dien-2-amine is sourced from PubChem (CID 142190252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).