C25H25ClN4O6 — CID 142190468
ethane;methyl (8S)-8-(chloromethyl)-4-hydroxy-2-methyl-6-(5-nitro-1H-indole-2-carbonyl)-7,8-dihydro-3H-pyrrolo[3,2-e]indole-1-carboxylate (PubChem CID 142190468) has the molecular formula C25H25ClN4O6 and a molecular weight of 512.95 g/mol. Its IUPAC name is ethane;methyl (8S)-8-(chloromethyl)-4-hydroxy-2-methyl-6-(5-nitro-1H-indole-2-carbonyl)-7,8-dihydro-3H-pyrrolo[3,2-e]indole-1-carboxylate.
| Compound Name | ethane;methyl (8S)-8-(chloromethyl)-4-hydroxy-2-methyl-6-(5-nitro-1H-indole-2-carbonyl)-7,8-dihydro-3H-pyrrolo[3,2-e]indole-1-carboxylate |
|---|---|
| PubChem CID | 142190468 |
| Molecular Formula | C25H25ClN4O6 |
| Molecular Weight | 512.95 g/mol |
| Exact Mass | 512.15 |
| IUPAC Name | ethane;methyl (8S)-8-(chloromethyl)-4-hydroxy-2-methyl-6-(5-nitro-1H-indole-2-carbonyl)-7,8-dihydro-3H-pyrrolo[3,2-e]indole-1-carboxylate |
| SMILES | CC.COC(=O)c1c(C)[nH]c2c(O)cc3c(c12)[C@H](CCl)CN3C(=O)c1cc2cc([N+](=O)[O-])ccc2[nH]1 |
| InChI | InChI=1S/C23H19ClN4O6.C2H6/c1-10-18(23(31)34-2)20-19-12(8-24)9-27(16(19)7-17(29)21(20)25-10)22(30)15-6-11-5-13(28(32)33)3-4-14(11)26-15;1-2/h3-7,12,25-26,29H,8-9H2,1-2H3;1-2H3/t12-;/m1./s1 |
| InChIKey | NROWDFBBVSVDTN-UTONKHPSSA-N |
| XLogP | 5.37 |
| TPSA | 141.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.95 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|