C14H19FN2 — CID 142190752
(Z)-3-[(3-fluorophenyl)methyl]-4-imino-5-methylhex-2-en-2-amine (PubChem CID 142190752) has the molecular formula C14H19FN2 and a molecular weight of 234.32 g/mol. Its IUPAC name is (Z)-3-[(3-fluorophenyl)methyl]-4-imino-5-methylhex-2-en-2-amine.
| Compound Name | (Z)-3-[(3-fluorophenyl)methyl]-4-imino-5-methylhex-2-en-2-amine |
|---|---|
| PubChem CID | 142190752 |
| Molecular Formula | C14H19FN2 |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | (Z)-3-[(3-fluorophenyl)methyl]-4-imino-5-methylhex-2-en-2-amine |
| SMILES | [H]/N=C(C(/Cc1cccc(F)c1)=C(/C)N)\C(C)C |
| InChI | InChI=1S/C14H19FN2/c1-9(2)14(17)13(10(3)16)8-11-5-4-6-12(15)7-11/h4-7,9,17H,8,16H2,1-3H3/b13-10-,17-14+ |
| InChIKey | PMOIRDYJNWJWSR-ICMDQPEBSA-N |
| XLogP | 3.28 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|