C21H28N2O5 — CID 142191033
tert-butyl N-[[2-[3-[hydroxy(methoxy)amino]-4-methylphenyl]-5-methoxyphenyl]methyl]carbamate (PubChem CID 142191033) has the molecular formula C21H28N2O5 and a molecular weight of 388.46 g/mol. Its IUPAC name is tert-butyl N-[[2-[3-[hydroxy(methoxy)amino]-4-methylphenyl]-5-methoxyphenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[2-[3-[hydroxy(methoxy)amino]-4-methylphenyl]-5-methoxyphenyl]methyl]carbamate |
|---|---|
| PubChem CID | 142191033 |
| Molecular Formula | C21H28N2O5 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | tert-butyl N-[[2-[3-[hydroxy(methoxy)amino]-4-methylphenyl]-5-methoxyphenyl]methyl]carbamate |
| SMILES | COc1ccc(-c2ccc(C)c(N(O)OC)c2)c(CNC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C21H28N2O5/c1-14-7-8-15(12-19(14)23(25)27-6)18-10-9-17(26-5)11-16(18)13-22-20(24)28-21(2,3)4/h7-12,25H,13H2,1-6H3,(H,22,24) |
| InChIKey | LBFSNHQXKVCLRW-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 80.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|