C25H31F5N2O2S — CID 142191634
3-butylsulfanyl-N-[1-(3,5-difluorophenyl)-3-hydroxy-4-[[3-(trifluoromethyl)phenyl]methylamino]butan-2-yl]propanamide (PubChem CID 142191634) has the molecular formula C25H31F5N2O2S and a molecular weight of 518.59 g/mol. Its IUPAC name is 3-butylsulfanyl-N-[1-(3,5-difluorophenyl)-3-hydroxy-4-[[3-(trifluoromethyl)phenyl]methylamino]butan-2-yl]propanamide.
| Compound Name | 3-butylsulfanyl-N-[1-(3,5-difluorophenyl)-3-hydroxy-4-[[3-(trifluoromethyl)phenyl]methylamino]butan-2-yl]propanamide |
|---|---|
| PubChem CID | 142191634 |
| Molecular Formula | C25H31F5N2O2S |
| Molecular Weight | 518.59 g/mol |
| Exact Mass | 518.20 |
| IUPAC Name | 3-butylsulfanyl-N-[1-(3,5-difluorophenyl)-3-hydroxy-4-[[3-(trifluoromethyl)phenyl]methylamino]butan-2-yl]propanamide |
| SMILES | CCCCSCCC(=O)NC(Cc1cc(F)cc(F)c1)C(O)CNCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H31F5N2O2S/c1-2-3-8-35-9-7-24(34)32-22(13-18-11-20(26)14-21(27)12-18)23(33)16-31-15-17-5-4-6-19(10-17)25(28,29)30/h4-6,10-12,14,22-23,31,33H,2-3,7-9,13,15-16H2,1H3,(H,32,34) |
| InChIKey | RZCVXXCDSPRBPZ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.59 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|