C29H43N3O4S — CID 142191748
N-[1-[3-[(3-ethylphenyl)methylamino]propylamino]-3-heptan-4-ylsulfonyl-1-oxopropan-2-yl]benzamide (PubChem CID 142191748) has the molecular formula C29H43N3O4S and a molecular weight of 529.75 g/mol. Its IUPAC name is N-[1-[3-[(3-ethylphenyl)methylamino]propylamino]-3-heptan-4-ylsulfonyl-1-oxopropan-2-yl]benzamide.
| Compound Name | N-[1-[3-[(3-ethylphenyl)methylamino]propylamino]-3-heptan-4-ylsulfonyl-1-oxopropan-2-yl]benzamide |
|---|---|
| PubChem CID | 142191748 |
| Molecular Formula | C29H43N3O4S |
| Molecular Weight | 529.75 g/mol |
| Exact Mass | 529.30 |
| IUPAC Name | N-[1-[3-[(3-ethylphenyl)methylamino]propylamino]-3-heptan-4-ylsulfonyl-1-oxopropan-2-yl]benzamide |
| SMILES | CCCC(CCC)S(=O)(=O)CC(NC(=O)c1ccccc1)C(=O)NCCCNCc1cccc(CC)c1 |
| InChI | InChI=1S/C29H43N3O4S/c1-4-12-26(13-5-2)37(35,36)22-27(32-28(33)25-16-8-7-9-17-25)29(34)31-19-11-18-30-21-24-15-10-14-23(6-3)20-24/h7-10,14-17,20,26-27,30H,4-6,11-13,18-19,21-22H2,1-3H3,(H,31,34)(H,32,33) |
| InChIKey | IMICHUJQCNAQGS-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.75 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|