C11H15F3N2O — CID 142191954
N-[(2E,3E)-4-(aminomethyl)-2-ethylidenehexa-3,5-dienyl]-2,2,2-trifluoroacetamide (PubChem CID 142191954) has the molecular formula C11H15F3N2O and a molecular weight of 248.25 g/mol. Its IUPAC name is N-[(2E,3E)-4-(aminomethyl)-2-ethylidenehexa-3,5-dienyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(2E,3E)-4-(aminomethyl)-2-ethylidenehexa-3,5-dienyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 142191954 |
| Molecular Formula | C11H15F3N2O |
| Molecular Weight | 248.25 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | N-[(2E,3E)-4-(aminomethyl)-2-ethylidenehexa-3,5-dienyl]-2,2,2-trifluoroacetamide |
| SMILES | C=C/C(=C\C(=C/C)CNC(=O)C(F)(F)F)CN |
| InChI | InChI=1S/C11H15F3N2O/c1-3-8(6-15)5-9(4-2)7-16-10(17)11(12,13)14/h3-5H,1,6-7,15H2,2H3,(H,16,17)/b8-5+,9-4+ |
| InChIKey | GPEAPBJEZZBUQP-CCMAPKILSA-N |
| XLogP | 1.68 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.25 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|