C15H15N3 — CID 142192316
1-benzylindole-2,3-diamine (PubChem CID 142192316) has the molecular formula C15H15N3 and a molecular weight of 237.31 g/mol. Its IUPAC name is 1-benzylindole-2,3-diamine.
| Compound Name | 1-benzylindole-2,3-diamine |
|---|---|
| PubChem CID | 142192316 |
| Molecular Formula | C15H15N3 |
| Molecular Weight | 237.31 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | 1-benzylindole-2,3-diamine |
| SMILES | Nc1c(N)n(Cc2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C15H15N3/c16-14-12-8-4-5-9-13(12)18(15(14)17)10-11-6-2-1-3-7-11/h1-9H,10,16-17H2 |
| InChIKey | VUCXPAXUDFMODM-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 56.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.31 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |