About 4-butyl-1-methylpiperidine;3-cyclohexyl-1-methylpiperidine;1-methylpiperidine
4-butyl-1-methylpiperidine;3-cyclohexyl-1-methylpiperidine;1-methylpiperidine (PubChem CID 142193414) has the molecular formula C28H57N3
and a molecular weight of 435.79 g/mol. Its IUPAC name is 4-butyl-1-methylpiperidine;3-cyclohexyl-1-methylpiperidine;1-methylpiperidine.
Molecular Properties
| Compound Name | 4-butyl-1-methylpiperidine;3-cyclohexyl-1-methylpiperidine;1-methylpiperidine |
| PubChem CID | 142193414 |
| Molecular Formula | C28H57N3 |
| Molecular Weight | 435.79 g/mol |
| Exact Mass | 435.46 |
| IUPAC Name | 4-butyl-1-methylpiperidine;3-cyclohexyl-1-methylpiperidine;1-methylpiperidine |
| SMILES | CCCCC1CCN(C)CC1.CN1CCCC(C2CCCCC2)C1.CN1CCCCC1 |
| InChI | InChI=1S/C12H23N.C10H21N.C6H13N/c1-13-9-5-8-12(10-13)11-6-3-2-4-7-11;1-3-4-5-10-6-8-11(2)9-7-10;1-7-5-3-2-4-6-7/h11-12H,2-10H2,1H3;10H,3-9H2,1-2H3;2-6H2,1H3 |
| InChIKey | FNXAHJRVAFDARY-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 435.79 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-butyl-1-methylpiperidine;3-cyclohexyl-1-methylpiperidine;1-methylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butyl-1-methylpiperidine;3-cyclohexyl-1-methylpiperidine;1-methylpiperidine?
The IUPAC name of 4-butyl-1-methylpiperidine;3-cyclohexyl-1-methylpiperidine;1-methylpiperidine (CID 142193414) is 4-butyl-1-methylpiperidine;3-cyclohexyl-1-methylpiperidine;1-methylpiperidine.
What is the SMILES notation for 4-butyl-1-methylpiperidine;3-cyclohexyl-1-methylpiperidine;1-methylpiperidine?
The canonical SMILES for 4-butyl-1-methylpiperidine;3-cyclohexyl-1-methylpiperidine;1-methylpiperidine is CCCCC1CCN(C)CC1.CN1CCCC(C2CCCCC2)C1.CN1CCCCC1.
What is the InChIKey of 4-butyl-1-methylpiperidine;3-cyclohexyl-1-methylpiperidine;1-methylpiperidine?
The InChIKey is FNXAHJRVAFDARY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23N.C10H21N.C6H13N/c1-13-9-5-8-12(10-13)11-6-3-2-4-7-11;1-3-4-5-10-6-8-11(2)9-7-10;1-7-5-3-2-4-6-7/h11-12H,2-10H2,1H3;10H,3-9H2,1-2H3;2-6H2,1H3.
What are the key properties of 4-butyl-1-methylpiperidine;3-cyclohexyl-1-methylpiperidine;1-methylpiperidine?
4-butyl-1-methylpiperidine;3-cyclohexyl-1-methylpiperidine;1-methylpiperidine has a molecular weight of 435.79 g/mol, XLogP of 6.53, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butyl-1-methylpiperidine;3-cyclohexyl-1-methylpiperidine;1-methylpiperidine is sourced from PubChem (CID 142193414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).