C14H30N2 — CID 142193447
ethane;N-[(1Z,3Z)-3-methylpenta-1,3-dienyl]methanimine;pentan-1-amine (PubChem CID 142193447) has the molecular formula C14H30N2 and a molecular weight of 226.41 g/mol. Its IUPAC name is ethane;N-[(1Z,3Z)-3-methylpenta-1,3-dienyl]methanimine;pentan-1-amine.
| Compound Name | ethane;N-[(1Z,3Z)-3-methylpenta-1,3-dienyl]methanimine;pentan-1-amine |
|---|---|
| PubChem CID | 142193447 |
| Molecular Formula | C14H30N2 |
| Molecular Weight | 226.41 g/mol |
| Exact Mass | 226.24 |
| IUPAC Name | ethane;N-[(1Z,3Z)-3-methylpenta-1,3-dienyl]methanimine;pentan-1-amine |
| SMILES | C=N/C=C\C(C)=C/C.CC.CCCCCN |
| InChI | InChI=1S/C7H11N.C5H13N.C2H6/c1-4-7(2)5-6-8-3;1-2-3-4-5-6;1-2/h4-6H,3H2,1-2H3;2-6H2,1H3;1-2H3/b6-5-,7-4-;; |
| InChIKey | ZZLLRKXSOBZRDN-CWBRYBGWSA-N |
| XLogP | 4.33 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.41 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|