About 1,4-dimethyl-N-pentyl-2H-pyridin-2-amine;ethane
1,4-dimethyl-N-pentyl-2H-pyridin-2-amine;ethane (PubChem CID 142193483) has the molecular formula C14H28N2
and a molecular weight of 224.39 g/mol. Its IUPAC name is 1,4-dimethyl-N-pentyl-2H-pyridin-2-amine;ethane.
Molecular Properties
| Compound Name | 1,4-dimethyl-N-pentyl-2H-pyridin-2-amine;ethane |
| PubChem CID | 142193483 |
| Molecular Formula | C14H28N2 |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.23 |
| IUPAC Name | 1,4-dimethyl-N-pentyl-2H-pyridin-2-amine;ethane |
| SMILES | CC.CCCCCNC1C=C(C)C=CN1C |
| InChI | InChI=1S/C12H22N2.C2H6/c1-4-5-6-8-13-12-10-11(2)7-9-14(12)3;1-2/h7,9-10,12-13H,4-6,8H2,1-3H3;1-2H3 |
| InChIKey | CJDMOJJWNBZPAQ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1,4-dimethyl-N-pentyl-2H-pyridin-2-amine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dimethyl-N-pentyl-2H-pyridin-2-amine;ethane?
The IUPAC name of 1,4-dimethyl-N-pentyl-2H-pyridin-2-amine;ethane (CID 142193483) is 1,4-dimethyl-N-pentyl-2H-pyridin-2-amine;ethane.
What is the SMILES notation for 1,4-dimethyl-N-pentyl-2H-pyridin-2-amine;ethane?
The canonical SMILES for 1,4-dimethyl-N-pentyl-2H-pyridin-2-amine;ethane is CC.CCCCCNC1C=C(C)C=CN1C.
What is the InChIKey of 1,4-dimethyl-N-pentyl-2H-pyridin-2-amine;ethane?
The InChIKey is CJDMOJJWNBZPAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2.C2H6/c1-4-5-6-8-13-12-10-11(2)7-9-14(12)3;1-2/h7,9-10,12-13H,4-6,8H2,1-3H3;1-2H3.
What are the key properties of 1,4-dimethyl-N-pentyl-2H-pyridin-2-amine;ethane?
1,4-dimethyl-N-pentyl-2H-pyridin-2-amine;ethane has a molecular weight of 224.39 g/mol, XLogP of 3.52, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dimethyl-N-pentyl-2H-pyridin-2-amine;ethane is sourced from PubChem (CID 142193483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).