About 2-[4-benzyl-2-[(3,4-dichlorophenyl)methyl]piperidin-1-yl]ethanamine
2-[4-benzyl-2-[(3,4-dichlorophenyl)methyl]piperidin-1-yl]ethanamine (PubChem CID 142193593) has the molecular formula C21H26Cl2N2
and a molecular weight of 377.36 g/mol. Its IUPAC name is 2-[4-benzyl-2-[(3,4-dichlorophenyl)methyl]piperidin-1-yl]ethanamine.
Molecular Properties
| Compound Name | 2-[4-benzyl-2-[(3,4-dichlorophenyl)methyl]piperidin-1-yl]ethanamine |
| PubChem CID | 142193593 |
| Molecular Formula | C21H26Cl2N2 |
| Molecular Weight | 377.36 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | 2-[4-benzyl-2-[(3,4-dichlorophenyl)methyl]piperidin-1-yl]ethanamine |
| SMILES | NCCN1CCC(Cc2ccccc2)CC1Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C21H26Cl2N2/c22-20-7-6-17(15-21(20)23)13-19-14-18(8-10-25(19)11-9-24)12-16-4-2-1-3-5-16/h1-7,15,18-19H,8-14,24H2 |
| InChIKey | YPWDRWNVLZAPIN-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.36 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[4-benzyl-2-[(3,4-dichlorophenyl)methyl]piperidin-1-yl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-benzyl-2-[(3,4-dichlorophenyl)methyl]piperidin-1-yl]ethanamine?
The IUPAC name of 2-[4-benzyl-2-[(3,4-dichlorophenyl)methyl]piperidin-1-yl]ethanamine (CID 142193593) is 2-[4-benzyl-2-[(3,4-dichlorophenyl)methyl]piperidin-1-yl]ethanamine.
What is the SMILES notation for 2-[4-benzyl-2-[(3,4-dichlorophenyl)methyl]piperidin-1-yl]ethanamine?
The canonical SMILES for 2-[4-benzyl-2-[(3,4-dichlorophenyl)methyl]piperidin-1-yl]ethanamine is NCCN1CCC(Cc2ccccc2)CC1Cc1ccc(Cl)c(Cl)c1.
What is the InChIKey of 2-[4-benzyl-2-[(3,4-dichlorophenyl)methyl]piperidin-1-yl]ethanamine?
The InChIKey is YPWDRWNVLZAPIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26Cl2N2/c22-20-7-6-17(15-21(20)23)13-19-14-18(8-10-25(19)11-9-24)12-16-4-2-1-3-5-16/h1-7,15,18-19H,8-14,24H2.
What are the key properties of 2-[4-benzyl-2-[(3,4-dichlorophenyl)methyl]piperidin-1-yl]ethanamine?
2-[4-benzyl-2-[(3,4-dichlorophenyl)methyl]piperidin-1-yl]ethanamine has a molecular weight of 377.36 g/mol, XLogP of 4.82, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-benzyl-2-[(3,4-dichlorophenyl)methyl]piperidin-1-yl]ethanamine is sourced from PubChem (CID 142193593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).